C29H31N3OS — CID 137047378
N-(2,5-dimethylphenyl)-2-[(2-methyl-1H-indol-3-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 137047378) has the molecular formula C29H31N3OS and a molecular weight of 469.65 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(2-methyl-1H-indol-3-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(2-methyl-1H-indol-3-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 137047378 |
| Molecular Formula | C29H31N3OS |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(2-methyl-1H-indol-3-yl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2c(N=Cc3c(C)[nH]c4ccccc34)sc3c2CCCCCC3)c1 |
| InChI | InChI=1S/C29H31N3OS/c1-18-14-15-19(2)25(16-18)32-28(33)27-22-11-6-4-5-7-13-26(22)34-29(27)30-17-23-20(3)31-24-12-9-8-10-21(23)24/h8-10,12,14-17,31H,4-7,11,13H2,1-3H3,(H,32,33) |
| InChIKey | ZVJHPVPEHOUFLH-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|