C50H30N4O10 — CID 137047637
6-[10-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-pyren-1-yl-1,3,5-triazin-2-yl]-9-pyridin-4-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 137047637) has the molecular formula C50H30N4O10 and a molecular weight of 846.81 g/mol. Its IUPAC name is 6-[10-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-pyren-1-yl-1,3,5-triazin-2-yl]-9-pyridin-4-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-pyren-1-yl-1,3,5-triazin-2-yl]-9-pyridin-4-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 137047637 |
| Molecular Formula | C50H30N4O10 |
| Molecular Weight | 846.81 g/mol |
| Exact Mass | 846.20 |
| IUPAC Name | 6-[10-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-pyren-1-yl-1,3,5-triazin-2-yl]-9-pyridin-4-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2ccc3c(-c4nc(-c5c(O)c(O)c(O)c(O)c5O)nc(-c5ccc6ccc7cccc8ccc5c6c78)n4)c4ccccc4c(-c4ccncc4)c3c2)c(O)c1O |
| InChI | InChI=1S/C50H30N4O10/c55-38-35(39(56)43(60)46(63)42(38)59)25-12-14-29-31(20-25)33(24-16-18-51-19-17-24)26-6-1-2-7-27(26)36(29)49-52-48(53-50(54-49)37-40(57)44(61)47(64)45(62)41(37)58)30-15-11-23-9-8-21-4-3-5-22-10-13-28(30)34(23)32(21)22/h1-20,55-64H |
| InChIKey | SMPZXKXUDIXGOG-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 253.86 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.81 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|