C16H15N3O2 — CID 137054165
6-[5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]naphthalen-2-ol (PubChem CID 137054165) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-[5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]naphthalen-2-ol.
| Compound Name | 6-[5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 137054165 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 6-[5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]naphthalen-2-ol |
| SMILES | Oc1ccc2cc(-c3noc([C@@H]4CCCN4)n3)ccc2c1 |
| InChI | InChI=1S/C16H15N3O2/c20-13-6-5-10-8-12(4-3-11(10)9-13)15-18-16(21-19-15)14-2-1-7-17-14/h3-6,8-9,14,17,20H,1-2,7H2/t14-/m0/s1 |
| InChIKey | MCPXUFVHRCVGJJ-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |