C21H13ClN4O4 — CID 137058329
3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 137058329) has the molecular formula C21H13ClN4O4 and a molecular weight of 420.81 g/mol. Its IUPAC name is 3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 137058329 |
| Molecular Formula | C21H13ClN4O4 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 3-[(3-chloro-4-hydroxy-5-nitrophenyl)methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1cc(Cl)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13ClN4O4/c22-16-10-13(11-18(19(16)27)26(29)30)12-23-25-20(14-6-2-1-3-7-14)24-17-9-5-4-8-15(17)21(25)28/h1-12,27H |
| InChIKey | UODMUXLWPNMLGJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|