C16H13Cl2FN2O3 — CID 137061468
4,6-dichloro-2-[(2,4-dimethoxyphenyl)methyl]-7-fluoropyrrolo[3,4-c]pyridin-3-ol (PubChem CID 137061468) has the molecular formula C16H13Cl2FN2O3 and a molecular weight of 371.20 g/mol. Its IUPAC name is 4,6-dichloro-2-[(2,4-dimethoxyphenyl)methyl]-7-fluoropyrrolo[3,4-c]pyridin-3-ol.
| Compound Name | 4,6-dichloro-2-[(2,4-dimethoxyphenyl)methyl]-7-fluoropyrrolo[3,4-c]pyridin-3-ol |
|---|---|
| PubChem CID | 137061468 |
| Molecular Formula | C16H13Cl2FN2O3 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 4,6-dichloro-2-[(2,4-dimethoxyphenyl)methyl]-7-fluoropyrrolo[3,4-c]pyridin-3-ol |
| SMILES | COc1ccc(Cn2cc3c(F)c(Cl)nc(Cl)c3c2O)c(OC)c1 |
| InChI | InChI=1S/C16H13Cl2FN2O3/c1-23-9-4-3-8(11(5-9)24-2)6-21-7-10-12(16(21)22)14(17)20-15(18)13(10)19/h3-5,7,22H,6H2,1-2H3 |
| InChIKey | AEUKSLKHDHNZBF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|