C17H15Cl2FN2O3 — CID 137098274
4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methylpyrrolo[3,4-c]pyridin-3-ol (PubChem CID 137098274) has the molecular formula C17H15Cl2FN2O3 and a molecular weight of 385.22 g/mol. Its IUPAC name is 4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methylpyrrolo[3,4-c]pyridin-3-ol.
| Compound Name | 4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methylpyrrolo[3,4-c]pyridin-3-ol |
|---|---|
| PubChem CID | 137098274 |
| Molecular Formula | C17H15Cl2FN2O3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methylpyrrolo[3,4-c]pyridin-3-ol |
| SMILES | COc1cc(Cn2c(C)c3c(F)c(Cl)nc(Cl)c3c2O)cc(OC)c1 |
| InChI | InChI=1S/C17H15Cl2FN2O3/c1-8-12-13(15(18)21-16(19)14(12)20)17(23)22(8)7-9-4-10(24-2)6-11(5-9)25-3/h4-6,23H,7H2,1-3H3 |
| InChIKey | UEIMTNXNAFOFDG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|