C17H17Cl2FN2O2 — CID 141301456
4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methyl-1,3-dihydropyrrolo[3,4-c]pyridine (PubChem CID 141301456) has the molecular formula C17H17Cl2FN2O2 and a molecular weight of 371.24 g/mol. Its IUPAC name is 4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methyl-1,3-dihydropyrrolo[3,4-c]pyridine.
| Compound Name | 4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methyl-1,3-dihydropyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 141301456 |
| Molecular Formula | C17H17Cl2FN2O2 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4,6-dichloro-2-[(3,5-dimethoxyphenyl)methyl]-7-fluoro-1-methyl-1,3-dihydropyrrolo[3,4-c]pyridine |
| SMILES | COc1cc(CN2Cc3c(Cl)nc(Cl)c(F)c3C2C)cc(OC)c1 |
| InChI | InChI=1S/C17H17Cl2FN2O2/c1-9-14-13(16(18)21-17(19)15(14)20)8-22(9)7-10-4-11(23-2)6-12(5-10)24-3/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | WSQAUOMCKKMCEC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|