C28H20ClIN2O3S — CID 137062766
(5E)-2-(3-chlorophenyl)imino-5-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137062766) has the molecular formula C28H20ClIN2O3S and a molecular weight of 626.90 g/mol. Its IUPAC name is (5E)-2-(3-chlorophenyl)imino-5-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-chlorophenyl)imino-5-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137062766 |
| Molecular Formula | C28H20ClIN2O3S |
| Molecular Weight | 626.90 g/mol |
| Exact Mass | 625.99 |
| IUPAC Name | (5E)-2-(3-chlorophenyl)imino-5-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3)NC2=O)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H20ClIN2O3S/c1-34-24-13-17(14-25-27(33)32-28(36-25)31-21-10-5-9-20(29)15-21)12-23(30)26(24)35-16-19-8-4-7-18-6-2-3-11-22(18)19/h2-15H,16H2,1H3,(H,31,32,33)/b25-14+ |
| InChIKey | AJNXGLVJAVIOSM-AFUMVMLFSA-N |
| XLogP | 7.58 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.90 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|