C13H17N3O2S — CID 137064142
2-methylimino-5-(pyridin-3-ylmethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol (PubChem CID 137064142) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-methylimino-5-(pyridin-3-ylmethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol.
| Compound Name | 2-methylimino-5-(pyridin-3-ylmethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol |
|---|---|
| PubChem CID | 137064142 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-methylimino-5-(pyridin-3-ylmethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol |
| SMILES | C/N=C1/NC2C(O)CC(Cc3cccnc3)OC2S1 |
| InChI | InChI=1S/C13H17N3O2S/c1-14-13-16-11-10(17)6-9(18-12(11)19-13)5-8-3-2-4-15-7-8/h2-4,7,9-12,17H,5-6H2,1H3,(H,14,16) |
| InChIKey | MJDOMRHMAXYISG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|