C13H17N3O3S2 — CID 137153910
5-[hydroxy(pyridin-3-yl)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137153910) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-[hydroxy(pyridin-3-yl)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 5-[hydroxy(pyridin-3-yl)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137153910 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 5-[hydroxy(pyridin-3-yl)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C/N=C1/NC2C(S1)SC(C(O)c1cccnc1)C(O)C2O |
| InChI | InChI=1S/C13H17N3O3S2/c1-14-13-16-7-9(18)10(19)11(20-12(7)21-13)8(17)6-3-2-4-15-5-6/h2-5,7-12,17-19H,1H3,(H,14,16) |
| InChIKey | REQZJMOBRFKGGT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|