C28H27ClN2O2 — CID 137065512
4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-chloro-6-ethoxyphenol (PubChem CID 137065512) has the molecular formula C28H27ClN2O2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-chloro-6-ethoxyphenol.
| Compound Name | 4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-chloro-6-ethoxyphenol |
|---|---|
| PubChem CID | 137065512 |
| Molecular Formula | C28H27ClN2O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-chloro-6-ethoxyphenol |
| SMILES | CCOc1cc(/C=N/c2ccc([C@@H]3Nc4ccc(C)cc4[C@@H]4C=CC[C@@H]43)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C28H27ClN2O2/c1-3-33-26-15-18(14-24(29)28(26)32)16-30-20-10-8-19(9-11-20)27-22-6-4-5-21(22)23-13-17(2)7-12-25(23)31-27/h4-5,7-16,21-22,27,31-32H,3,6H2,1-2H3/b30-16+/t21-,22+,27+/m1/s1 |
| InChIKey | KLAYAOBTDJNTBF-WYJNLUMOSA-N |
| XLogP | 7.33 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|