C26H23BrN2O — CID 137065663
4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-bromophenol (PubChem CID 137065663) has the molecular formula C26H23BrN2O and a molecular weight of 459.39 g/mol. Its IUPAC name is 4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-bromophenol.
| Compound Name | 4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-bromophenol |
|---|---|
| PubChem CID | 137065663 |
| Molecular Formula | C26H23BrN2O |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 4-[[4-[(3aS,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-bromophenol |
| SMILES | Cc1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccc(/N=C/c3ccc(O)c(Br)c3)cc1)N2 |
| InChI | InChI=1S/C26H23BrN2O/c1-16-5-11-24-22(13-16)20-3-2-4-21(20)26(29-24)18-7-9-19(10-8-18)28-15-17-6-12-25(30)23(27)14-17/h2-3,5-15,20-21,26,29-30H,4H2,1H3/b28-15+/t20-,21+,26+/m1/s1 |
| InChIKey | RQMJNHLGUARUSD-LSSBKUKYSA-N |
| XLogP | 7.04 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|