C26H24N2O — CID 4129283
4-[[4-(8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl]iminomethyl]phenol (PubChem CID 4129283) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-[[4-(8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl]iminomethyl]phenol.
| Compound Name | 4-[[4-(8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 4129283 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 4-[[4-(8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl]iminomethyl]phenol |
| SMILES | Cc1ccc2c(c1)C1C=CCC1C(c1ccc(/N=C/c3ccc(O)cc3)cc1)N2 |
| InChI | InChI=1S/C26H24N2O/c1-17-5-14-25-24(15-17)22-3-2-4-23(22)26(28-25)19-8-10-20(11-9-19)27-16-18-6-12-21(29)13-7-18/h2-3,5-16,22-23,26,28-29H,4H2,1H3/b27-16+ |
| InChIKey | XCVAGNAIAKKPKT-JVWAILMASA-N |
| XLogP | 6.28 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|