C13H20N4O3 — CID 137065733
(3S)-3-hydroxy-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxamide (PubChem CID 137065733) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is (3S)-3-hydroxy-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-hydroxy-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 137065733 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3S)-3-hydroxy-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(CCNC(=O)N2CCC[C@H](O)C2)n1 |
| InChI | InChI=1S/C13H20N4O3/c1-9-7-12(19)16-11(15-9)4-5-14-13(20)17-6-2-3-10(18)8-17/h7,10,18H,2-6,8H2,1H3,(H,14,20)(H,15,16,19)/t10-/m0/s1 |
| InChIKey | KMJFATZYTKFQER-JTQLQIEISA-N |
| XLogP | -0.21 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |