C18H21ClN4O3 — CID 137150789
2-(4-chlorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]morpholine-4-carboxamide (PubChem CID 137150789) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]morpholine-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 137150789 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]morpholine-4-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(CCNC(=O)N2CCOC(c3ccc(Cl)cc3)C2)n1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-12-10-17(24)22-16(21-12)6-7-20-18(25)23-8-9-26-15(11-23)13-2-4-14(19)5-3-13/h2-5,10,15H,6-9,11H2,1H3,(H,20,25)(H,21,22,24) |
| InChIKey | MGJGNFYTSVMTFC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |