C21H26N4O2 — CID 136930406
(1S,3S,8R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide (PubChem CID 136930406) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (1S,3S,8R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1S,3S,8R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 136930406 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (1S,3S,8R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(CCNC(=O)[C@H]2C[C@@H](c3ccccc3)N3CCC[C@H]23)n1 |
| InChI | InChI=1S/C21H26N4O2/c1-14-12-20(26)24-19(23-14)9-10-22-21(27)16-13-18(15-6-3-2-4-7-15)25-11-5-8-17(16)25/h2-4,6-7,12,16-18H,5,8-11,13H2,1H3,(H,22,27)(H,23,24,26)/t16-,17+,18-/m0/s1 |
| InChIKey | LSSPYIBSXQFUTQ-KSZLIROESA-N |
| XLogP | 1.96 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |