C16H21N3O2 — CID 118768835
(1S,3S,8R)-N-(2-amino-2-oxoethyl)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide (PubChem CID 118768835) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1S,3S,8R)-N-(2-amino-2-oxoethyl)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1S,3S,8R)-N-(2-amino-2-oxoethyl)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 118768835 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (1S,3S,8R)-N-(2-amino-2-oxoethyl)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
| SMILES | NC(=O)CNC(=O)[C@H]1C[C@@H](c2ccccc2)N2CCC[C@H]12 |
| InChI | InChI=1S/C16H21N3O2/c17-15(20)10-18-16(21)12-9-14(11-5-2-1-3-6-11)19-8-4-7-13(12)19/h1-3,5-6,12-14H,4,7-10H2,(H2,17,20)(H,18,21)/t12-,13+,14-/m0/s1 |
| InChIKey | DGLDEEQKSPIVDK-MJBXVCDLSA-N |
| XLogP | 0.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |