C20H29N3O2 — CID 118789504
[4-(2-hydroxyethyl)piperazin-1-yl]-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanone (PubChem CID 118789504) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is [4-(2-hydroxyethyl)piperazin-1-yl]-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanone.
| Compound Name | [4-(2-hydroxyethyl)piperazin-1-yl]-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanone |
|---|---|
| PubChem CID | 118789504 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | [4-(2-hydroxyethyl)piperazin-1-yl]-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanone |
| SMILES | O=C([C@H]1C[C@@H](c2ccccc2)N2CCC[C@H]12)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C20H29N3O2/c24-14-13-21-9-11-22(12-10-21)20(25)17-15-19(16-5-2-1-3-6-16)23-8-4-7-18(17)23/h1-3,5-6,17-19,24H,4,7-15H2/t17-,18+,19-/m0/s1 |
| InChIKey | DZFJNPFVWFHOID-OTWHNJEPSA-N |
| XLogP | 1.35 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |