C24H29N3O — CID 118761914
(1S,3S,8R)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide (PubChem CID 118761914) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (1S,3S,8R)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1S,3S,8R)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 118761914 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (1S,3S,8R)-N-[2-(2,3-dihydroindol-1-yl)ethyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
| SMILES | O=C(NCCN1CCc2ccccc21)[C@H]1C[C@@H](c2ccccc2)N2CCC[C@H]12 |
| InChI | InChI=1S/C24H29N3O/c28-24(25-13-16-26-15-12-19-9-4-5-10-21(19)26)20-17-23(18-7-2-1-3-8-18)27-14-6-11-22(20)27/h1-5,7-10,20,22-23H,6,11-17H2,(H,25,28)/t20-,22+,23-/m0/s1 |
| InChIKey | FFDIGKMYGVFOSD-WWNPGLIZSA-N |
| XLogP | 3.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |