C22H24N4O2 — CID 118795268
(1S,3S,8R)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide (PubChem CID 118795268) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1S,3S,8R)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1S,3S,8R)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 118795268 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1S,3S,8R)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
| SMILES | O=C(NCc1ccc2[nH]c(=O)[nH]c2c1)[C@H]1C[C@@H](c2ccccc2)N2CCC[C@H]12 |
| InChI | InChI=1S/C22H24N4O2/c27-21(23-13-14-8-9-17-18(11-14)25-22(28)24-17)16-12-20(15-5-2-1-3-6-15)26-10-4-7-19(16)26/h1-3,5-6,8-9,11,16,19-20H,4,7,10,12-13H2,(H,23,27)(H2,24,25,28)/t16-,19+,20-/m0/s1 |
| InChIKey | SRGLQWXBLPETNX-DBVUQKKJSA-N |
| XLogP | 2.70 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |