C21H30N2O2 — CID 118762746
(1S,3S,8R)-N-[1-(methoxymethyl)cyclopentyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide (PubChem CID 118762746) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (1S,3S,8R)-N-[1-(methoxymethyl)cyclopentyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1S,3S,8R)-N-[1-(methoxymethyl)cyclopentyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 118762746 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (1S,3S,8R)-N-[1-(methoxymethyl)cyclopentyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
| SMILES | COCC1(NC(=O)[C@H]2C[C@@H](c3ccccc3)N3CCC[C@H]23)CCCC1 |
| InChI | InChI=1S/C21H30N2O2/c1-25-15-21(11-5-6-12-21)22-20(24)17-14-19(16-8-3-2-4-9-16)23-13-7-10-18(17)23/h2-4,8-9,17-19H,5-7,10-15H2,1H3,(H,22,24)/t17-,18+,19-/m0/s1 |
| InChIKey | WOPDANNWQVPFAZ-OTWHNJEPSA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |