C21H23BrN4O2 — CID 137068245
6-bromo-2-[(2S)-butan-2-yl]-3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 137068245) has the molecular formula C21H23BrN4O2 and a molecular weight of 443.35 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 137068245 |
| Molecular Formula | C21H23BrN4O2 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(N(C)C)cc1O |
| InChI | InChI=1S/C21H23BrN4O2/c1-5-13(2)20-24-18-9-7-15(22)10-17(18)21(28)26(20)23-12-14-6-8-16(25(3)4)11-19(14)27/h6-13,27H,5H2,1-4H3/t13-/m0/s1 |
| InChIKey | XMIZQROKLYTDGO-ZDUSSCGKSA-N |
| XLogP | 4.33 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|