C22H21Br2ClN2O2S — CID 137070940
(5E)-2-(4-chlorophenyl)imino-5-[(3,5-dibromo-4-hexoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137070940) has the molecular formula C22H21Br2ClN2O2S and a molecular weight of 572.75 g/mol. Its IUPAC name is (5E)-2-(4-chlorophenyl)imino-5-[(3,5-dibromo-4-hexoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-chlorophenyl)imino-5-[(3,5-dibromo-4-hexoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137070940 |
| Molecular Formula | C22H21Br2ClN2O2S |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 569.94 |
| IUPAC Name | (5E)-2-(4-chlorophenyl)imino-5-[(3,5-dibromo-4-hexoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCCCOc1c(Br)cc(/C=C2/S/C(=N\c3ccc(Cl)cc3)NC2=O)cc1Br |
| InChI | InChI=1S/C22H21Br2ClN2O2S/c1-2-3-4-5-10-29-20-17(23)11-14(12-18(20)24)13-19-21(28)27-22(30-19)26-16-8-6-15(25)7-9-16/h6-9,11-13H,2-5,10H2,1H3,(H,26,27,28)/b19-13+ |
| InChIKey | SXJMWNPBCBJFKF-CPNJWEJPSA-N |
| XLogP | 7.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|