C17H18N6O4 — CID 137074713
6-hydroxy-5-[(2-oxo-6-piperidin-1-yl-1,3-dihydrobenzimidazol-5-yl)iminomethyl]-1H-pyrimidine-2,4-dione (PubChem CID 137074713) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is 6-hydroxy-5-[(2-oxo-6-piperidin-1-yl-1,3-dihydrobenzimidazol-5-yl)iminomethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(2-oxo-6-piperidin-1-yl-1,3-dihydrobenzimidazol-5-yl)iminomethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137074713 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 6-hydroxy-5-[(2-oxo-6-piperidin-1-yl-1,3-dihydrobenzimidazol-5-yl)iminomethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C=N/c2cc3[nH]c(=O)[nH]c3cc2N2CCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N6O4/c24-14-9(15(25)22-17(27)21-14)8-18-12-6-10-11(20-16(26)19-10)7-13(12)23-4-2-1-3-5-23/h6-8H,1-5H2,(H2,19,20,26)(H3,21,22,24,25,27)/b18-8+ |
| InChIKey | LUMFRXQSZUSESQ-QGMBQPNBSA-N |
| XLogP | 0.68 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|