C14H11N3O6 — CID 136835129
5-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 136835129) has the molecular formula C14H11N3O6 and a molecular weight of 317.26 g/mol. Its IUPAC name is 5-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136835129 |
| Molecular Formula | C14H11N3O6 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=C1CCCc2oc(=O)c(/N=C/c3c(O)[nH]c(=O)[nH]c3=O)cc21 |
| InChI | InChI=1S/C14H11N3O6/c18-9-2-1-3-10-6(9)4-8(13(21)23-10)15-5-7-11(19)16-14(22)17-12(7)20/h4-5H,1-3H2,(H3,16,17,19,20,22)/b15-5+ |
| InChIKey | JMRQMWPMVAZGQE-PJQLUOCWSA-N |
| XLogP | -0.01 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|