C20H15N7O2 — CID 137076272
(8R)-8-(4-hydroxyphenyl)-10-[(E)-2-phenylethenyl]-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076272) has the molecular formula C20H15N7O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is (8R)-8-(4-hydroxyphenyl)-10-[(E)-2-phenylethenyl]-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(4-hydroxyphenyl)-10-[(E)-2-phenylethenyl]-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076272 |
| Molecular Formula | C20H15N7O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (8R)-8-(4-hydroxyphenyl)-10-[(E)-2-phenylethenyl]-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(/C=C/c2ccccc2)c2c1Nc1nnnn1[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C20H15N7O2/c28-14-9-7-13(8-10-14)18-16-15(11-6-12-4-2-1-3-5-12)22-23-19(29)17(16)21-20-24-25-26-27(18)20/h1-11,18,28H,(H,23,29)(H,21,24,26)/b11-6+/t18-/m1/s1 |
| InChIKey | LOPHLCCNTYOUMN-PMQIGOLDSA-N |
| XLogP | 2.33 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |