C12H13N3O — CID 137078496
(2Z)-2-[[4-hydroxy-3-(methylamino)phenyl]methylidene]-3-iminobutanenitrile (PubChem CID 137078496) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is (2Z)-2-[[4-hydroxy-3-(methylamino)phenyl]methylidene]-3-iminobutanenitrile.
| Compound Name | (2Z)-2-[[4-hydroxy-3-(methylamino)phenyl]methylidene]-3-iminobutanenitrile |
|---|---|
| PubChem CID | 137078496 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (2Z)-2-[[4-hydroxy-3-(methylamino)phenyl]methylidene]-3-iminobutanenitrile |
| SMILES | [H]/N=C(C)/C(C#N)=C/c1ccc(O)c(NC)c1 |
| InChI | InChI=1S/C12H13N3O/c1-8(14)10(7-13)5-9-3-4-12(16)11(6-9)15-2/h3-6,14-16H,1-2H3/b10-5+,14-8+ |
| InChIKey | SZCIIFFBSSBDTH-MMKWLFFMSA-N |
| XLogP | 2.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|