C14H15N3 — CID 142085260
(2Z)-2-[(2,6-dimethylphenyl)methylidene]-3,4-diiminopentanenitrile (PubChem CID 142085260) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (2Z)-2-[(2,6-dimethylphenyl)methylidene]-3,4-diiminopentanenitrile.
| Compound Name | (2Z)-2-[(2,6-dimethylphenyl)methylidene]-3,4-diiminopentanenitrile |
|---|---|
| PubChem CID | 142085260 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (2Z)-2-[(2,6-dimethylphenyl)methylidene]-3,4-diiminopentanenitrile |
| SMILES | [H]/N=C(C(/C#N)=C/c1c(C)cccc1C)\C(C)=N\[H] |
| InChI | InChI=1S/C14H15N3/c1-9-5-4-6-10(2)13(9)7-12(8-15)14(17)11(3)16/h4-7,16-17H,1-3H3/b12-7+,16-11+,17-14+ |
| InChIKey | SANIZMCKNYHHSH-CBWKIZERSA-N |
| XLogP | 3.27 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|