C14H18N4 — CID 142085232
3,4-diimino-2-methylidenehexanenitrile;2-methylaniline (PubChem CID 142085232) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 3,4-diimino-2-methylidenehexanenitrile;2-methylaniline.
| Compound Name | 3,4-diimino-2-methylidenehexanenitrile;2-methylaniline |
|---|---|
| PubChem CID | 142085232 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3,4-diimino-2-methylidenehexanenitrile;2-methylaniline |
| SMILES | Cc1ccccc1N.[H]/N=C(CC)/C(=N/[H])C(=C)C#N |
| InChI | InChI=1S/C7H9N3.C7H9N/c1-3-6(9)7(10)5(2)4-8;1-6-4-2-3-5-7(6)8/h9-10H,2-3H2,1H3;2-5H,8H2,1H3/b9-6+,10-7+; |
| InChIKey | AVTJHQCTRMRXQG-BHSKDUGMSA-N |
| XLogP | 3.09 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|