C16H27N4O4P — CID 137079128
7-[(5-diethoxyphosphorylpentylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 137079128) has the molecular formula C16H27N4O4P and a molecular weight of 370.39 g/mol. Its IUPAC name is 7-[(5-diethoxyphosphorylpentylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(5-diethoxyphosphorylpentylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137079128 |
| Molecular Formula | C16H27N4O4P |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 7-[(5-diethoxyphosphorylpentylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCOP(=O)(CCCCCNCc1c[nH]c2c(=O)[nH]cnc12)OCC |
| InChI | InChI=1S/C16H27N4O4P/c1-3-23-25(22,24-4-2)9-7-5-6-8-17-10-13-11-18-15-14(13)19-12-20-16(15)21/h11-12,17-18H,3-10H2,1-2H3,(H,19,20,21) |
| InChIKey | DLICJKRBFHJKDK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|