C13H20N4OS — CID 135981856
7-[(4-ethylsulfanylbutylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135981856) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 7-[(4-ethylsulfanylbutylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(4-ethylsulfanylbutylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135981856 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 7-[(4-ethylsulfanylbutylamino)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCSCCCCNCc1c[nH]c2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C13H20N4OS/c1-2-19-6-4-3-5-14-7-10-8-15-12-11(10)16-9-17-13(12)18/h8-9,14-15H,2-7H2,1H3,(H,16,17,18) |
| InChIKey | LELWVLXFUUQWTA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|