C6H5ClN2O2 — CID 137079336
(2E)-N,5-dihydroxypyridine-2-carboximidoyl chloride (PubChem CID 137079336) has the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. Its IUPAC name is (2E)-N,5-dihydroxypyridine-2-carboximidoyl chloride.
| Compound Name | (2E)-N,5-dihydroxypyridine-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 137079336 |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.57 g/mol |
| Exact Mass | 172.00 |
| IUPAC Name | (2E)-N,5-dihydroxypyridine-2-carboximidoyl chloride |
| SMILES | O/N=C(/Cl)c1ccc(O)cn1 |
| InChI | InChI=1S/C6H5ClN2O2/c7-6(9-11)5-2-1-4(10)3-8-5/h1-3,10-11H/b9-6+ |
| InChIKey | WOSHONURTHYSQV-RMKNXTFCSA-N |
| XLogP | 1.16 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|