C18H13F3N6O2 — CID 137084603
4-[hydroxy-[[6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]amino]methyl]-1H-pyrimidin-6-one (PubChem CID 137084603) has the molecular formula C18H13F3N6O2 and a molecular weight of 402.34 g/mol. Its IUPAC name is 4-[hydroxy-[[6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]amino]methyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[hydroxy-[[6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]amino]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137084603 |
| Molecular Formula | C18H13F3N6O2 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-[hydroxy-[[6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-3-yl]amino]methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(O)Nc2cnc3ccc(-c4ccccc4C(F)(F)F)nn23)nc[nH]1 |
| InChI | InChI=1S/C18H13F3N6O2/c19-18(20,21)11-4-2-1-3-10(11)12-5-6-14-22-8-15(27(14)26-12)25-17(29)13-7-16(28)24-9-23-13/h1-9,17,25,29H,(H,23,24,28) |
| InChIKey | ZPRIVCOBODZWKZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|