C19H19NO4S — CID 137086108
ethyl (5Z)-4-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137086108) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137086108 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/C=C/c2ccccc2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C19H19NO4S/c1-3-15(21)20-18-16(19(23)24-4-2)17(22)14(25-18)12-8-11-13-9-6-5-7-10-13/h5-12,22H,3-4H2,1-2H3/b11-8+,14-12-,20-18- |
| InChIKey | FKWWSUMLMJZJNO-LIEDRFNJSA-N |
| XLogP | 4.04 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|