C21H24N2O4S — CID 137027007
ethyl (5Z)-4-hydroxy-2-propanoylimino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 137027007) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-2-propanoylimino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-2-propanoylimino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027007 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-2-propanoylimino-5-[(4-pyrrolidin-1-ylphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(N3CCCC3)cc2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C21H24N2O4S/c1-3-17(24)22-20-18(21(26)27-4-2)19(25)16(28-20)13-14-7-9-15(10-8-14)23-11-5-6-12-23/h7-10,13,25H,3-6,11-12H2,1-2H3/b16-13-,22-20- |
| InChIKey | YWJYKECVTWXTRD-JBBBKHMRSA-N |
| XLogP | 4.08 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|