C36H41N3O — CID 137086333
2-[4-(3-tert-butyl-5-pyridin-2-ylphenyl)-1-(2-ethylhexyl)benzimidazol-2-yl]phenol (PubChem CID 137086333) has the molecular formula C36H41N3O and a molecular weight of 531.74 g/mol. Its IUPAC name is 2-[4-(3-tert-butyl-5-pyridin-2-ylphenyl)-1-(2-ethylhexyl)benzimidazol-2-yl]phenol.
| Compound Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylphenyl)-1-(2-ethylhexyl)benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 137086333 |
| Molecular Formula | C36H41N3O |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylphenyl)-1-(2-ethylhexyl)benzimidazol-2-yl]phenol |
| SMILES | CCCCC(CC)Cn1c(-c2ccccc2O)nc2c(-c3cc(-c4ccccn4)cc(C(C)(C)C)c3)cccc21 |
| InChI | InChI=1S/C36H41N3O/c1-6-8-14-25(7-2)24-39-32-18-13-16-29(34(32)38-35(39)30-15-9-10-19-33(30)40)26-21-27(31-17-11-12-20-37-31)23-28(22-26)36(3,4)5/h9-13,15-23,25,40H,6-8,14,24H2,1-5H3 |
| InChIKey | UQQDISLHQLFSIX-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |