C22H18BrF3N4O4S — CID 137093643
[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate (PubChem CID 137093643) has the molecular formula C22H18BrF3N4O4S and a molecular weight of 571.38 g/mol. Its IUPAC name is [2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate.
| Compound Name | [2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137093643 |
| Molecular Formula | C22H18BrF3N4O4S |
| Molecular Weight | 571.38 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | [2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate |
| SMILES | Cn1c(O)c(/C(=N/c2ccccc2)SCC(=O)Nc2ccc(Br)cc2C(F)(F)F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H18BrF3N4O4S/c1-29-19(32)17(20(33)30(2)21(29)34)18(27-13-6-4-3-5-7-13)35-11-16(31)28-15-9-8-12(23)10-14(15)22(24,25)26/h3-10,32H,11H2,1-2H3,(H,28,31)/b27-18- |
| InChIKey | UUYBXLIILKDQAX-IMRQLAEWSA-N |
| XLogP | 4.02 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|