C17H15N3O3 — CID 137098387
6-hydroxy-1,3-dimethyl-5-(naphthalen-2-yliminomethyl)pyrimidine-2,4-dione (PubChem CID 137098387) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-(naphthalen-2-yliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-(naphthalen-2-yliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137098387 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-(naphthalen-2-yliminomethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/C=N/c2ccc3ccccc3c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H15N3O3/c1-19-15(21)14(16(22)20(2)17(19)23)10-18-13-8-7-11-5-3-4-6-12(11)9-13/h3-10,21H,1-2H3/b18-10+ |
| InChIKey | WFHMSJHPZYJTJV-VCHYOVAHSA-N |
| XLogP | 1.69 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|