C38H34F7N4O6P — CID 137099331
2-bis(phenylmethoxy)phosphoryl-5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-4H-1,2,4-triazol-3-one (PubChem CID 137099331) has the molecular formula C38H34F7N4O6P and a molecular weight of 806.67 g/mol. Its IUPAC name is 2-bis(phenylmethoxy)phosphoryl-5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-4H-1,2,4-triazol-3-one.
| Compound Name | 2-bis(phenylmethoxy)phosphoryl-5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 137099331 |
| Molecular Formula | C38H34F7N4O6P |
| Molecular Weight | 806.67 g/mol |
| Exact Mass | 806.21 |
| IUPAC Name | 2-bis(phenylmethoxy)phosphoryl-5-[[2-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-4H-1,2,4-triazol-3-one |
| SMILES | C=CC(OC1OCCN(Cc2nn(P(=O)(OCc3ccccc3)OCc3ccccc3)c(=O)[nH]2)C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H34F7N4O6P/c1-2-32(28-19-29(37(40,41)42)21-30(20-28)38(43,44)45)55-35-34(27-13-15-31(39)16-14-27)48(17-18-52-35)22-33-46-36(50)49(47-33)56(51,53-23-25-9-5-3-6-10-25)54-24-26-11-7-4-8-12-26/h2-16,19-21,32,34-35H,1,17-18,22-24H2,(H,46,47,50) |
| InChIKey | NRZQNPYNFFLXSX-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.67 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|