C26H21N3O8 — CID 137099998
[4-[[(2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene)amino]carbamoyl]phenyl] 3-nitrobenzoate (PubChem CID 137099998) has the molecular formula C26H21N3O8 and a molecular weight of 503.47 g/mol. Its IUPAC name is [4-[[(2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene)amino]carbamoyl]phenyl] 3-nitrobenzoate.
| Compound Name | [4-[[(2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene)amino]carbamoyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 137099998 |
| Molecular Formula | C26H21N3O8 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | [4-[[(2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene)amino]carbamoyl]phenyl] 3-nitrobenzoate |
| SMILES | CCOC(=O)C(C=NNC(=O)c1ccc(OC(=O)c2cccc([N+](=O)[O-])c2)cc1)=C(O)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O8/c1-2-36-26(33)22(23(30)17-7-4-3-5-8-17)16-27-28-24(31)18-11-13-21(14-12-18)37-25(32)19-9-6-10-20(15-19)29(34)35/h3-16,30H,2H2,1H3,(H,28,31) |
| InChIKey | IZWSFCVULWMVSA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|