C12H10ClN3O3S — CID 137100075
2-[1-(4-chlorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 137100075) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | 2-[1-(4-chlorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 137100075 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | NC(=O)CSc1nc(O)cc(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClN3O3S/c13-7-1-3-8(4-2-7)16-11(19)5-10(18)15-12(16)20-6-9(14)17/h1-5,18H,6H2,(H2,14,17) |
| InChIKey | ZCHOFLGRTOHGOP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |