About methoxyiminomethylurea
methoxyiminomethylurea (PubChem CID 137107007) has the molecular formula C3H7N3O2
and a molecular weight of 117.11 g/mol. Its IUPAC name is methoxyiminomethylurea.
Molecular Properties
| Compound Name | methoxyiminomethylurea |
| PubChem CID | 137107007 |
| Molecular Formula | C3H7N3O2 |
| Molecular Weight | 117.11 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | methoxyiminomethylurea |
| SMILES | CON=CNC(N)=O |
| InChI | InChI=1S/C3H7N3O2/c1-8-6-2-5-3(4)7/h2H,1H3,(H3,4,5,6,7) |
| InChIKey | KWJSIZOACUFYBK-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.11 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxyiminomethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyiminomethylurea?
The IUPAC name of methoxyiminomethylurea (CID 137107007) is methoxyiminomethylurea.
What is the SMILES notation for methoxyiminomethylurea?
The canonical SMILES for methoxyiminomethylurea is CON=CNC(N)=O.
What is the InChIKey of methoxyiminomethylurea?
The InChIKey is KWJSIZOACUFYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O2/c1-8-6-2-5-3(4)7/h2H,1H3,(H3,4,5,6,7).
What are the key properties of methoxyiminomethylurea?
methoxyiminomethylurea has a molecular weight of 117.11 g/mol, XLogP of -0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyiminomethylurea is sourced from PubChem (CID 137107007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).