C14H12N4O2S2 — CID 137108476
5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137108476) has the molecular formula C14H12N4O2S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137108476 |
| Molecular Formula | C14H12N4O2S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/N=C1\NC(=O)C(=Cc2cnc(N)s2)S1 |
| InChI | InChI=1S/C14H12N4O2S2/c1-20-10-5-3-2-4-9(10)17-14-18-12(19)11(22-14)6-8-7-16-13(15)21-8/h2-7H,1H3,(H2,15,16)(H,17,18,19) |
| InChIKey | FOJLHYYWPFSRIO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|