C14H10N6OS2 — CID 137099356
5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one (PubChem CID 137099356) has the molecular formula C14H10N6OS2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137099356 |
| Molecular Formula | C14H10N6OS2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one |
| SMILES | Nc1ncc(C=C2S/C(=N\c3ccc4cn[nH]c4c3)NC2=O)s1 |
| InChI | InChI=1S/C14H10N6OS2/c15-13-16-6-9(22-13)4-11-12(21)19-14(23-11)18-8-2-1-7-5-17-20-10(7)3-8/h1-6H,(H2,15,16)(H,17,20)(H,18,19,21) |
| InChIKey | CHCWDRJWHPXWKH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|