C18H15N5O2S2 — CID 137044981
N-[5-[[2-(1-methylindol-6-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 137044981) has the molecular formula C18H15N5O2S2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[5-[[2-(1-methylindol-6-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[2-(1-methylindol-6-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 137044981 |
| Molecular Formula | C18H15N5O2S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[5-[[2-(1-methylindol-6-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(C=C2S/C(=N\c3ccc4ccn(C)c4c3)NC2=O)s1 |
| InChI | InChI=1S/C18H15N5O2S2/c1-10(24)20-17-19-9-13(26-17)8-15-16(25)22-18(27-15)21-12-4-3-11-5-6-23(2)14(11)7-12/h3-9H,1-2H3,(H,19,20,24)(H,21,22,25) |
| InChIKey | NEWXKPYNHGKRCR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|