C21H16N4O5S2 — CID 137169628
4-[[5-[[2-(3-hydroxynaphthalen-2-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid (PubChem CID 137169628) has the molecular formula C21H16N4O5S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 4-[[5-[[2-(3-hydroxynaphthalen-2-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[5-[[2-(3-hydroxynaphthalen-2-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 137169628 |
| Molecular Formula | C21H16N4O5S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 4-[[5-[[2-(3-hydroxynaphthalen-2-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ncc(C=C2S/C(=N/c3cc4ccccc4cc3O)NC2=O)s1 |
| InChI | InChI=1S/C21H16N4O5S2/c26-15-8-12-4-2-1-3-11(12)7-14(15)23-21-25-19(30)16(32-21)9-13-10-22-20(31-13)24-17(27)5-6-18(28)29/h1-4,7-10,26H,5-6H2,(H,28,29)(H,22,24,27)(H,23,25,30) |
| InChIKey | MMCODJOZBHEHFD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|