C21H24N6O2S2 — CID 137023194
N-[5-[[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]-4-methylpiperazine-1-carboxamide (PubChem CID 137023194) has the molecular formula C21H24N6O2S2 and a molecular weight of 456.60 g/mol. Its IUPAC name is N-[5-[[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[5-[[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 137023194 |
| Molecular Formula | C21H24N6O2S2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[5-[[2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]-4-methylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(/N=C2/NC(=O)C(=Cc3cnc(NC(=O)N4CCN(C)CC4)s3)S2)c(C)c1 |
| InChI | InChI=1S/C21H24N6O2S2/c1-13-4-5-16(14(2)10-13)23-20-24-18(28)17(31-20)11-15-12-22-19(30-15)25-21(29)27-8-6-26(3)7-9-27/h4-5,10-12H,6-9H2,1-3H3,(H,22,25,29)(H,23,24,28) |
| InChIKey | ODGVVTWHZZJNCY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|