C18H17N5O3S2 — CID 137139971
N-[4-[[5-[(2-acetamido-1,3-thiazol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenyl]acetamide (PubChem CID 137139971) has the molecular formula C18H17N5O3S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[4-[[5-[(2-acetamido-1,3-thiazol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenyl]acetamide.
| Compound Name | N-[4-[[5-[(2-acetamido-1,3-thiazol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 137139971 |
| Molecular Formula | C18H17N5O3S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[4-[[5-[(2-acetamido-1,3-thiazol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C2/NC(=O)C(=Cc3cnc(NC(C)=O)s3)S2)c(C)c1 |
| InChI | InChI=1S/C18H17N5O3S2/c1-9-6-12(20-10(2)24)4-5-14(9)22-18-23-16(26)15(28-18)7-13-8-19-17(27-13)21-11(3)25/h4-8H,1-3H3,(H,20,24)(H,19,21,25)(H,22,23,26) |
| InChIKey | CZIJAJIKUFXJEN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|