C22H27N5OS2 — CID 137037535
2-(2,4-dimethylphenyl)imino-5-[[2-(3-pyrrolidin-3-ylpropylamino)-1,3-thiazol-5-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137037535) has the molecular formula C22H27N5OS2 and a molecular weight of 441.63 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)imino-5-[[2-(3-pyrrolidin-3-ylpropylamino)-1,3-thiazol-5-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,4-dimethylphenyl)imino-5-[[2-(3-pyrrolidin-3-ylpropylamino)-1,3-thiazol-5-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137037535 |
| Molecular Formula | C22H27N5OS2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-(2,4-dimethylphenyl)imino-5-[[2-(3-pyrrolidin-3-ylpropylamino)-1,3-thiazol-5-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)C(=Cc3cnc(NCCCC4CCNC4)s3)S2)c(C)c1 |
| InChI | InChI=1S/C22H27N5OS2/c1-14-5-6-18(15(2)10-14)26-22-27-20(28)19(30-22)11-17-13-25-21(29-17)24-8-3-4-16-7-9-23-12-16/h5-6,10-11,13,16,23H,3-4,7-9,12H2,1-2H3,(H,24,25)(H,26,27,28) |
| InChIKey | OBAJFYMXMNSGNR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|