C20H23N7OS2 — CID 137082149
5-[[2-[4-(dimethylamino)butylamino]-1,3-thiazol-5-yl]methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one (PubChem CID 137082149) has the molecular formula C20H23N7OS2 and a molecular weight of 441.59 g/mol. Its IUPAC name is 5-[[2-[4-(dimethylamino)butylamino]-1,3-thiazol-5-yl]methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[4-(dimethylamino)butylamino]-1,3-thiazol-5-yl]methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137082149 |
| Molecular Formula | C20H23N7OS2 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 5-[[2-[4-(dimethylamino)butylamino]-1,3-thiazol-5-yl]methylidene]-2-(1H-indazol-6-ylimino)-1,3-thiazolidin-4-one |
| SMILES | CN(C)CCCCNc1ncc(C=C2S/C(=N\c3ccc4cn[nH]c4c3)NC2=O)s1 |
| InChI | InChI=1S/C20H23N7OS2/c1-27(2)8-4-3-7-21-19-22-12-15(29-19)10-17-18(28)25-20(30-17)24-14-6-5-13-11-23-26-16(13)9-14/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,21,22)(H,23,26)(H,24,25,28) |
| InChIKey | GDCRVCBQVLEBMX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|